C14H14Cl5N5 — CID 118250242
1-N-[4-(3,4-dichlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine (PubChem CID 118250242) has the molecular formula C14H14Cl5N5 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-N-[4-(3,4-dichlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-[4-(3,4-dichlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 118250242 |
| Molecular Formula | C14H14Cl5N5 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 1-N-[4-(3,4-dichlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CNc1nc(-c2ccc(Cl)c(Cl)c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C14H14Cl5N5/c1-13(2,20)6-21-12-23-10(22-11(24-12)14(17,18)19)7-3-4-8(15)9(16)5-7/h3-5H,6,20H2,1-2H3,(H,21,22,23,24) |
| InChIKey | ZWBGLOMFBQIRLQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|