C14H8Cl8N4O — CID 175283566
4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloro-N-(2-chloroethyl)benzamide (PubChem CID 175283566) has the molecular formula C14H8Cl8N4O and a molecular weight of 531.87 g/mol. Its IUPAC name is 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloro-N-(2-chloroethyl)benzamide.
| Compound Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloro-N-(2-chloroethyl)benzamide |
|---|---|
| PubChem CID | 175283566 |
| Molecular Formula | C14H8Cl8N4O |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 527.82 |
| IUPAC Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloro-N-(2-chloroethyl)benzamide |
| SMILES | O=C(NCCCl)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1Cl |
| InChI | InChI=1S/C14H8Cl8N4O/c15-3-4-23-10(27)7-2-1-6(5-8(7)16)9-24-11(13(17,18)19)26-12(25-9)14(20,21)22/h1-2,5H,3-4H2,(H,23,27) |
| InChIKey | UEJBVFVYOBTLFO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|