C16H11Cl7N4O3 — CID 174704092
ethyl 2-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-chlorobenzoyl]amino]acetate (PubChem CID 174704092) has the molecular formula C16H11Cl7N4O3 and a molecular weight of 555.46 g/mol. Its IUPAC name is ethyl 2-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-chlorobenzoyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-chlorobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 174704092 |
| Molecular Formula | C16H11Cl7N4O3 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 551.87 |
| IUPAC Name | ethyl 2-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-chlorobenzoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl7N4O3/c1-2-30-10(28)6-24-12(29)7-3-4-8(9(17)5-7)11-25-13(15(18,19)20)27-14(26-11)16(21,22)23/h3-5H,2,6H2,1H3,(H,24,29) |
| InChIKey | MPKUEAURPNUWTI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|