C15H11BrCl6N4O2 — CID 57161719
ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-bromoanilino]acetate (PubChem CID 57161719) has the molecular formula C15H11BrCl6N4O2 and a molecular weight of 571.90 g/mol. Its IUPAC name is ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-bromoanilino]acetate.
| Compound Name | ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-bromoanilino]acetate |
|---|---|
| PubChem CID | 57161719 |
| Molecular Formula | C15H11BrCl6N4O2 |
| Molecular Weight | 571.90 g/mol |
| Exact Mass | 567.82 |
| IUPAC Name | ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-bromoanilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1Br |
| InChI | InChI=1S/C15H11BrCl6N4O2/c1-2-28-10(27)6-23-9-4-3-7(5-8(9)16)11-24-12(14(17,18)19)26-13(25-11)15(20,21)22/h3-5,23H,2,6H2,1H3 |
| InChIKey | XPDUVNAZDGENHS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.90 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|