C15H11Cl7N4O2 — CID 57135003
ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloroanilino]acetate (PubChem CID 57135003) has the molecular formula C15H11Cl7N4O2 and a molecular weight of 527.45 g/mol. Its IUPAC name is ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloroanilino]acetate.
| Compound Name | ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloroanilino]acetate |
|---|---|
| PubChem CID | 57135003 |
| Molecular Formula | C15H11Cl7N4O2 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 523.87 |
| IUPAC Name | ethyl 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-chloroanilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1Cl |
| InChI | InChI=1S/C15H11Cl7N4O2/c1-2-28-10(27)6-23-9-4-3-7(5-8(9)16)11-24-12(14(17,18)19)26-13(25-11)15(20,21)22/h3-5,23H,2,6H2,1H3 |
| InChIKey | UIHQYKKLUMEBAU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|