C21H19ClFN3O3 — CID 58134499
ethyl 2-[[6-(4-chloro-3-fluorophenyl)-2-(4-methoxyphenyl)pyrimidin-4-yl]amino]acetate (PubChem CID 58134499) has the molecular formula C21H19ClFN3O3 and a molecular weight of 415.85 g/mol. Its IUPAC name is ethyl 2-[[6-(4-chloro-3-fluorophenyl)-2-(4-methoxyphenyl)pyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-(4-chloro-3-fluorophenyl)-2-(4-methoxyphenyl)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 58134499 |
| Molecular Formula | C21H19ClFN3O3 |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | ethyl 2-[[6-(4-chloro-3-fluorophenyl)-2-(4-methoxyphenyl)pyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1cc(-c2ccc(Cl)c(F)c2)nc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C21H19ClFN3O3/c1-3-29-20(27)12-24-19-11-18(14-6-9-16(22)17(23)10-14)25-21(26-19)13-4-7-15(28-2)8-5-13/h4-11H,3,12H2,1-2H3,(H,24,25,26) |
| InChIKey | FXTWOAZNPMSNEB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |