C20H22Cl6N4O4 — CID 87100583
ethyl 2-[(2-ethoxy-2-oxoethyl)amino]acetate;2-(2-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 87100583) has the molecular formula C20H22Cl6N4O4 and a molecular weight of 595.14 g/mol. Its IUPAC name is ethyl 2-[(2-ethoxy-2-oxoethyl)amino]acetate;2-(2-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | ethyl 2-[(2-ethoxy-2-oxoethyl)amino]acetate;2-(2-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 87100583 |
| Molecular Formula | C20H22Cl6N4O4 |
| Molecular Weight | 595.14 g/mol |
| Exact Mass | 591.98 |
| IUPAC Name | ethyl 2-[(2-ethoxy-2-oxoethyl)amino]acetate;2-(2-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | CCOC(=O)CNCC(=O)OCC.Cc1ccccc1-c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H7Cl6N3.C8H15NO4/c1-6-4-2-3-5-7(6)8-19-9(11(13,14)15)21-10(20-8)12(16,17)18;1-3-12-7(10)5-9-6-8(11)13-4-2/h2-5H,1H3;9H,3-6H2,1-2H3 |
| InChIKey | FAPXFKRYEIIPFY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.14 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|