C10H4Cl5N3OS — CID 13041524
2,4-dichloro-N-[3-(trichloromethyl)-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 13041524) has the molecular formula C10H4Cl5N3OS and a molecular weight of 391.49 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(trichloromethyl)-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-(trichloromethyl)-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 13041524 |
| Molecular Formula | C10H4Cl5N3OS |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 388.85 |
| IUPAC Name | 2,4-dichloro-N-[3-(trichloromethyl)-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | O=C(Nc1nc(C(Cl)(Cl)Cl)ns1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H4Cl5N3OS/c11-4-1-2-5(6(12)3-4)7(19)16-9-17-8(18-20-9)10(13,14)15/h1-3H,(H,16,17,18,19) |
| InChIKey | UABAEOBFMDHOAV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|