About 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide
2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 108726565) has the molecular formula C13H13Cl2N3OS
and a molecular weight of 330.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 108726565 |
| Molecular Formula | C13H13Cl2N3OS |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CN(C)Cc1csc(NC(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H13Cl2N3OS/c1-18(2)6-9-7-20-13(16-9)17-12(19)10-4-3-8(14)5-11(10)15/h3-5,7H,6H2,1-2H3,(H,16,17,19) |
| InChIKey | CWIZECNRGOPGPC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide?
The IUPAC name of 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide (CID 108726565) is 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide is CN(C)Cc1csc(NC(=O)c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide?
The InChIKey is CWIZECNRGOPGPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2N3OS/c1-18(2)6-9-7-20-13(16-9)17-12(19)10-4-3-8(14)5-11(10)15/h3-5,7H,6H2,1-2H3,(H,16,17,19).
What are the key properties of 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide?
2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide has a molecular weight of 330.24 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 108726565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).