C12H19N3 — CID 141285669
N-[2-(1-methylpyrrolidin-2-yl)ethyl]pyridin-2-amine (PubChem CID 141285669) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-[2-(1-methylpyrrolidin-2-yl)ethyl]pyridin-2-amine.
| Compound Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 141285669 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]pyridin-2-amine |
| SMILES | CN1CCCC1CCNc1ccccn1 |
| InChI | InChI=1S/C12H19N3/c1-15-10-4-5-11(15)7-9-14-12-6-2-3-8-13-12/h2-3,6,8,11H,4-5,7,9-10H2,1H3,(H,13,14) |
| InChIKey | BEQBFYGHXAPUNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |