C19H25Cl3N4O — CID 118250398
4-[(2-methoxyphenyl)methyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(trichloromethyl)-2H-1,3,5-triazine (PubChem CID 118250398) has the molecular formula C19H25Cl3N4O and a molecular weight of 431.80 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(trichloromethyl)-2H-1,3,5-triazine.
| Compound Name | 4-[(2-methoxyphenyl)methyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(trichloromethyl)-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 118250398 |
| Molecular Formula | C19H25Cl3N4O |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 4-[(2-methoxyphenyl)methyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(trichloromethyl)-2H-1,3,5-triazine |
| SMILES | COc1ccccc1CC1=NC(C(Cl)(Cl)Cl)N(CCC2CCCN2C)C=N1 |
| InChI | InChI=1S/C19H25Cl3N4O/c1-25-10-5-7-15(25)9-11-26-13-23-17(24-18(26)19(20,21)22)12-14-6-3-4-8-16(14)27-2/h3-4,6,8,13,15,18H,5,7,9-12H2,1-2H3 |
| InChIKey | FZPXSKDGPCQZAF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|