C17H17Cl3F3N5 — CID 135235593
N-(2-pyrrolidin-3-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 135235593) has the molecular formula C17H17Cl3F3N5 and a molecular weight of 454.71 g/mol. Its IUPAC name is N-(2-pyrrolidin-3-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-(2-pyrrolidin-3-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 135235593 |
| Molecular Formula | C17H17Cl3F3N5 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-(2-pyrrolidin-3-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1cccc(-c2nc(NCCC3CCNC3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C17H17Cl3F3N5/c18-16(19,20)14-26-13(11-2-1-3-12(8-11)17(21,22)23)27-15(28-14)25-7-5-10-4-6-24-9-10/h1-3,8,10,24H,4-7,9H2,(H,25,26,27,28) |
| InChIKey | CGNQTSFCOXDJHV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|