C11H14F3N3 — CID 78990195
N-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 78990195) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is N-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 78990195 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | N-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cccc(NCC2CCNC2)n1 |
| InChI | InChI=1S/C11H14F3N3/c12-11(13,14)9-2-1-3-10(17-9)16-7-8-4-5-15-6-8/h1-3,8,15H,4-7H2,(H,16,17) |
| InChIKey | VJBSQKKMXQBLQW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |