C22H27F2N7 — CID 56646931
6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 56646931) has the molecular formula C22H27F2N7 and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56646931 |
| Molecular Formula | C22H27F2N7 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)CCCNc1nc(NCc2ccc(F)cc2)nc(NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H27F2N7/c1-31(2)13-3-12-25-20-28-21(26-14-16-4-8-18(23)9-5-16)30-22(29-20)27-15-17-6-10-19(24)11-7-17/h4-11H,3,12-15H2,1-2H3,(H3,25,26,27,28,29,30) |
| InChIKey | ZOJBIQIDWSBSBO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|