C20H18F2N6 — CID 90158889
2-N,4-N-bis[(4-fluorophenyl)methyl]-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 90158889) has the molecular formula C20H18F2N6 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-N,4-N-bis[(4-fluorophenyl)methyl]-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(4-fluorophenyl)methyl]-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90158889 |
| Molecular Formula | C20H18F2N6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-N,4-N-bis[(4-fluorophenyl)methyl]-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C#CCNc1nc(NCc2ccc(F)cc2)nc(NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H18F2N6/c1-2-11-23-18-26-19(24-12-14-3-7-16(21)8-4-14)28-20(27-18)25-13-15-5-9-17(22)10-6-15/h1,3-10H,11-13H2,(H3,23,24,25,26,27,28) |
| InChIKey | DZGRBSMCGRZDKE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|