C16H19FN6 — CID 90158905
4-[2-[(4-fluorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine (PubChem CID 90158905) has the molecular formula C16H19FN6 and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-[(4-fluorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90158905 |
| Molecular Formula | C16H19FN6 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine |
| SMILES | C#CCNc1ncnc(NN(CCC)Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H19FN6/c1-3-9-18-15-19-12-20-16(21-15)22-23(10-4-2)11-13-5-7-14(17)8-6-13/h1,5-8,12H,4,9-11H2,2H3,(H2,18,19,20,21,22) |
| InChIKey | ZXFTYXHHBUKULK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|