C17H25FN6O — CID 90175607
2-N-[(4-fluorophenyl)methyl]-2-N-methoxy-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 90175607) has the molecular formula C17H25FN6O and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-N-[(4-fluorophenyl)methyl]-2-N-methoxy-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(4-fluorophenyl)methyl]-2-N-methoxy-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90175607 |
| Molecular Formula | C17H25FN6O |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-N-[(4-fluorophenyl)methyl]-2-N-methoxy-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(NCCC)nc(N(Cc2ccc(F)cc2)OC)n1 |
| InChI | InChI=1S/C17H25FN6O/c1-4-10-19-15-21-16(20-11-5-2)23-17(22-15)24(25-3)12-13-6-8-14(18)9-7-13/h6-9H,4-5,10-12H2,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | SJJMIQBVYMDJJF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|