C24H27F6N7 — CID 56647176
6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[[4-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 56647176) has the molecular formula C24H27F6N7 and a molecular weight of 527.52 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[[4-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[[4-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56647176 |
| Molecular Formula | C24H27F6N7 |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[[4-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)CCCNc1nc(NCc2ccc(C(F)(F)F)cc2)nc(NCc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C24H27F6N7/c1-37(2)13-3-12-31-20-34-21(32-14-16-4-8-18(9-5-16)23(25,26)27)36-22(35-20)33-15-17-6-10-19(11-7-17)24(28,29)30/h4-11H,3,12-15H2,1-2H3,(H3,31,32,33,34,35,36) |
| InChIKey | XGJLXNSFHIIVQQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|