C22H20ClFN8O3 — CID 71584376
2-chloro-N-[2-[[4-[(4-fluorophenyl)methylamino]-6-(prop-2-ynylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-nitrobenzamide (PubChem CID 71584376) has the molecular formula C22H20ClFN8O3 and a molecular weight of 498.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-[(4-fluorophenyl)methylamino]-6-(prop-2-ynylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[[4-[(4-fluorophenyl)methylamino]-6-(prop-2-ynylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 71584376 |
| Molecular Formula | C22H20ClFN8O3 |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 2-chloro-N-[2-[[4-[(4-fluorophenyl)methylamino]-6-(prop-2-ynylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-nitrobenzamide |
| SMILES | C#CCNc1nc(NCCNC(=O)c2cc([N+](=O)[O-])ccc2Cl)nc(NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H20ClFN8O3/c1-2-9-26-20-29-21(31-22(30-20)28-13-14-3-5-15(24)6-4-14)27-11-10-25-19(33)17-12-16(32(34)35)7-8-18(17)23/h1,3-8,12H,9-11,13H2,(H,25,33)(H3,26,27,28,29,30,31) |
| InChIKey | SPNZFAPTTABXAA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|