C23H20ClFN4O4 — CID 42747594
5-[(2-chloro-4-nitrobenzoyl)amino]-2-(dimethylamino)-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 42747594) has the molecular formula C23H20ClFN4O4 and a molecular weight of 470.89 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrobenzoyl)amino]-2-(dimethylamino)-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 5-[(2-chloro-4-nitrobenzoyl)amino]-2-(dimethylamino)-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42747594 |
| Molecular Formula | C23H20ClFN4O4 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 5-[(2-chloro-4-nitrobenzoyl)amino]-2-(dimethylamino)-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20ClFN4O4/c1-28(2)21-10-7-16(27-23(31)18-9-8-17(29(32)33)12-20(18)24)11-19(21)22(30)26-13-14-3-5-15(25)6-4-14/h3-12H,13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | RRQPZAIXWLHFGU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|