C19H21ClN3O3+ — CID 8532984
2-chloro-4-nitro-N-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 8532984) has the molecular formula C19H21ClN3O3+ and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 8532984 |
| Molecular Formula | C19H21ClN3O3+ |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-chloro-4-nitro-N-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C[NH+]2CCCC2)cc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H20ClN3O3/c20-18-11-16(23(25)26)7-8-17(18)19(24)21-12-14-3-5-15(6-4-14)13-22-9-1-2-10-22/h3-8,11H,1-2,9-10,12-13H2,(H,21,24)/p+1 |
| InChIKey | QTMUNCBTQINWDT-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|