C22H17ClFN3O4 — CID 26549686
2-chloro-N-[2-[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-4-nitrobenzamide (PubChem CID 26549686) has the molecular formula C22H17ClFN3O4 and a molecular weight of 441.85 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 26549686 |
| Molecular Formula | C22H17ClFN3O4 |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-chloro-N-[2-[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCc1ccc(F)cc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H17ClFN3O4/c23-19-13-16(27(30)31)9-10-17(19)22(29)26-20-4-2-1-3-18(20)21(28)25-12-11-14-5-7-15(24)8-6-14/h1-10,13H,11-12H2,(H,25,28)(H,26,29) |
| InChIKey | SECMJGXFGNZXSN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|