C22H22ClN3O4 — CID 29239537
2-chloro-N-[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-4-nitrobenzamide (PubChem CID 29239537) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 29239537 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-chloro-N-[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCC1=CCCCC1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H22ClN3O4/c23-19-14-16(26(29)30)10-11-17(19)22(28)25-20-9-5-4-8-18(20)21(27)24-13-12-15-6-2-1-3-7-15/h4-6,8-11,14H,1-3,7,12-13H2,(H,24,27)(H,25,28) |
| InChIKey | PALPPFFGAZGSCC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|