C23H16ClN3O4 — CID 24675881
2-chloro-4-nitro-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]benzamide (PubChem CID 24675881) has the molecular formula C23H16ClN3O4 and a molecular weight of 433.85 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 24675881 |
| Molecular Formula | C23H16ClN3O4 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCC#Cc1ccccc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H16ClN3O4/c24-20-15-17(27(30)31)12-13-18(20)23(29)26-21-11-5-4-10-19(21)22(28)25-14-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-13,15H,14H2,(H,25,28)(H,26,29) |
| InChIKey | WOVRIKGPBBCLBS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|