C18H13N3O3 — CID 75413903
6-nitro-N-(3-phenylprop-2-ynyl)-1H-indole-3-carboxamide (PubChem CID 75413903) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 6-nitro-N-(3-phenylprop-2-ynyl)-1H-indole-3-carboxamide.
| Compound Name | 6-nitro-N-(3-phenylprop-2-ynyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 75413903 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 6-nitro-N-(3-phenylprop-2-ynyl)-1H-indole-3-carboxamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1c[nH]c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C18H13N3O3/c22-18(19-10-4-7-13-5-2-1-3-6-13)16-12-20-17-11-14(21(23)24)8-9-15(16)17/h1-3,5-6,8-9,11-12,20H,10H2,(H,19,22) |
| InChIKey | JICMKGWUHWRNNT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|