C15H17N3O5 — CID 119220047
6-[(5-nitro-1H-indole-3-carbonyl)amino]hexanoic acid (PubChem CID 119220047) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 6-[(5-nitro-1H-indole-3-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(5-nitro-1H-indole-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 119220047 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-[(5-nitro-1H-indole-3-carbonyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1c[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H17N3O5/c19-14(20)4-2-1-3-7-16-15(21)12-9-17-13-6-5-10(18(22)23)8-11(12)13/h5-6,8-9,17H,1-4,7H2,(H,16,21)(H,19,20) |
| InChIKey | KXUUWJUMLZIWQI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|