C15H15N3O6 — CID 119235210
5-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]pentanoic acid (PubChem CID 119235210) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 5-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119235210 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 5-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1cc(=O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H15N3O6/c19-13-8-11(15(22)16-6-2-1-3-14(20)21)10-7-9(18(23)24)4-5-12(10)17-13/h4-5,7-8H,1-3,6H2,(H,16,22)(H,17,19)(H,20,21) |
| InChIKey | WYZHMNVCADLTLE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|