C17H17N3O7 — CID 120547522
2-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547522) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547522 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CCCOC1)c1cc(=O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H17N3O7/c21-14-7-12(11-6-10(20(25)26)3-4-13(11)18-14)16(22)19-15(17(23)24)9-2-1-5-27-8-9/h3-4,6-7,9,15H,1-2,5,8H2,(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | DHNTXQGSBOLNGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 151.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|