C20H18F2N2O4 — CID 120522577
6-[(2,7-difluoro-9-oxo-10H-acridine-4-carbonyl)amino]hexanoic acid (PubChem CID 120522577) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is 6-[(2,7-difluoro-9-oxo-10H-acridine-4-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(2,7-difluoro-9-oxo-10H-acridine-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120522577 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 6-[(2,7-difluoro-9-oxo-10H-acridine-4-carbonyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1cc(F)cc2c(=O)c3cc(F)ccc3[nH]c12 |
| InChI | InChI=1S/C20H18F2N2O4/c21-11-5-6-16-13(8-11)19(27)14-9-12(22)10-15(18(14)24-16)20(28)23-7-3-1-2-4-17(25)26/h5-6,8-10H,1-4,7H2,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | VEDNHXZOUNGONU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|