C19H20FN3O2 — CID 86802615
N-[3-(dimethylamino)propyl]-7-fluoro-9-oxo-10H-acridine-2-carboxamide (PubChem CID 86802615) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-7-fluoro-9-oxo-10H-acridine-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-7-fluoro-9-oxo-10H-acridine-2-carboxamide |
|---|---|
| PubChem CID | 86802615 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-7-fluoro-9-oxo-10H-acridine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc2[nH]c3ccc(F)cc3c(=O)c2c1 |
| InChI | InChI=1S/C19H20FN3O2/c1-23(2)9-3-8-21-19(25)12-4-6-16-14(10-12)18(24)15-11-13(20)5-7-17(15)22-16/h4-7,10-11H,3,8-9H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | UCMCWTQUPICYFP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|