C17H19N3O6 — CID 119190683
3-[2-methylpropyl-(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]propanoic acid (PubChem CID 119190683) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 3-[2-methylpropyl-(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]propanoic acid.
| Compound Name | 3-[2-methylpropyl-(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190683 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[2-methylpropyl-(6-nitro-2-oxo-1H-quinoline-4-carbonyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)c1cc(=O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H19N3O6/c1-10(2)9-19(6-5-16(22)23)17(24)13-8-15(21)18-14-4-3-11(20(25)26)7-12(13)14/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | PHESQVJBIYPNRQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 133.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|