C13H13N7O3 — CID 75523052
5-nitro-N-[2-(2H-tetrazol-5-yl)propyl]-1H-indole-3-carboxamide (PubChem CID 75523052) has the molecular formula C13H13N7O3 and a molecular weight of 315.29 g/mol. Its IUPAC name is 5-nitro-N-[2-(2H-tetrazol-5-yl)propyl]-1H-indole-3-carboxamide.
| Compound Name | 5-nitro-N-[2-(2H-tetrazol-5-yl)propyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 75523052 |
| Molecular Formula | C13H13N7O3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-nitro-N-[2-(2H-tetrazol-5-yl)propyl]-1H-indole-3-carboxamide |
| SMILES | CC(CNC(=O)c1c[nH]c2ccc([N+](=O)[O-])cc12)c1nn[nH]n1 |
| InChI | InChI=1S/C13H13N7O3/c1-7(12-16-18-19-17-12)5-15-13(21)10-6-14-11-3-2-8(20(22)23)4-9(10)11/h2-4,6-7,14H,5H2,1H3,(H,15,21)(H,16,17,18,19) |
| InChIKey | YXCCETRUXJFACD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|