C11H13N7O3 — CID 62175476
2-(ethylamino)-5-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 62175476) has the molecular formula C11H13N7O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-(ethylamino)-5-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 2-(ethylamino)-5-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 62175476 |
| Molecular Formula | C11H13N7O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-(ethylamino)-5-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | CCNc1ccc([N+](=O)[O-])cc1C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C11H13N7O3/c1-2-12-9-4-3-7(18(20)21)5-8(9)11(19)13-6-10-14-16-17-15-10/h3-5,12H,2,6H2,1H3,(H,13,19)(H,14,15,16,17) |
| InChIKey | GNSZGKZWLXYCPL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|