C13H19N3O5 — CID 62180083
2-(ethylamino)-N,N-bis(2-hydroxyethyl)-5-nitrobenzamide (PubChem CID 62180083) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(ethylamino)-N,N-bis(2-hydroxyethyl)-5-nitrobenzamide.
| Compound Name | 2-(ethylamino)-N,N-bis(2-hydroxyethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 62180083 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(ethylamino)-N,N-bis(2-hydroxyethyl)-5-nitrobenzamide |
| SMILES | CCNc1ccc([N+](=O)[O-])cc1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C13H19N3O5/c1-2-14-12-4-3-10(16(20)21)9-11(12)13(19)15(5-7-17)6-8-18/h3-4,9,14,17-18H,2,5-8H2,1H3 |
| InChIKey | IOHAQFCETADGEW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|