C32H41N15O — CID 45486434
2-[[4-(3-aminoanilino)-6-[2-[4-[[4-(3-aminoanilino)-6-[2-(dimethylamino)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]ethylamino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 45486434) has the molecular formula C32H41N15O and a molecular weight of 651.78 g/mol. Its IUPAC name is 2-[[4-(3-aminoanilino)-6-[2-[4-[[4-(3-aminoanilino)-6-[2-(dimethylamino)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]ethylamino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(3-aminoanilino)-6-[2-[4-[[4-(3-aminoanilino)-6-[2-(dimethylamino)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]ethylamino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 45486434 |
| Molecular Formula | C32H41N15O |
| Molecular Weight | 651.78 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | 2-[[4-(3-aminoanilino)-6-[2-[4-[[4-(3-aminoanilino)-6-[2-(dimethylamino)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]ethylamino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CN(C)CCNc1nc(Nc2ccc(CCNc3nc(NCCO)nc(Nc4cccc(N)c4)n3)cc2)nc(Nc2cccc(N)c2)n1 |
| InChI | InChI=1S/C32H41N15O/c1-47(2)17-15-36-28-43-30(46-32(44-28)40-26-8-4-6-23(34)20-26)38-24-11-9-21(10-12-24)13-14-35-27-41-29(37-16-18-48)45-31(42-27)39-25-7-3-5-22(33)19-25/h3-12,19-20,48H,13-18,33-34H2,1-2H3,(H3,35,37,39,41,42,45)(H3,36,38,40,43,44,46) |
| InChIKey | BCCURZONKXCDEI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 225.03 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|