C36H41N15O2 — CID 45486428
2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]-1-(3-aminophenyl)ethanol (PubChem CID 45486428) has the molecular formula C36H41N15O2 and a molecular weight of 715.83 g/mol. Its IUPAC name is 2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]-1-(3-aminophenyl)ethanol.
| Compound Name | 2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]-1-(3-aminophenyl)ethanol |
|---|---|
| PubChem CID | 45486428 |
| Molecular Formula | C36H41N15O2 |
| Molecular Weight | 715.83 g/mol |
| Exact Mass | 715.36 |
| IUPAC Name | 2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]-1-(3-aminophenyl)ethanol |
| SMILES | Nc1cccc(Nc2nc(NCCO)nc(NCCc3ccc(Nc4nc(NCC(O)c5cccc(N)c5)nc(Nc5cccc(N)c5)n4)cc3)n2)c1 |
| InChI | InChI=1S/C36H41N15O2/c37-24-5-1-4-23(18-24)30(53)21-42-33-49-34(51-36(50-33)45-29-9-3-7-26(39)20-29)43-27-12-10-22(11-13-27)14-15-40-31-46-32(41-16-17-52)48-35(47-31)44-28-8-2-6-25(38)19-28/h1-13,18-20,30,52-53H,14-17,21,37-39H2,(H3,40,41,44,46,47,48)(H3,42,43,45,49,50,51) |
| InChIKey | QBFLGGAPPXHPSJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 268.04 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|