C21H28N8 — CID 153324586
4-N,6-N-bis(4-aminophenyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 153324586) has the molecular formula C21H28N8 and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-N,6-N-bis(4-aminophenyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(4-aminophenyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 153324586 |
| Molecular Formula | C21H28N8 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 4-N,6-N-bis(4-aminophenyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCN(CCC)c1nc(Nc2ccc(N)cc2)nc(Nc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C21H28N8/c1-3-13-29(14-4-2)21-27-19(24-17-9-5-15(22)6-10-17)26-20(28-21)25-18-11-7-16(23)8-12-18/h5-12H,3-4,13-14,22-23H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | IVCIOAAWLVVTOE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|