C11H14N6 — CID 150827570
2-N-(4-aminophenyl)-4-N-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 150827570) has the molecular formula C11H14N6 and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-N-(4-aminophenyl)-4-N-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-aminophenyl)-4-N-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 150827570 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-N-(4-aminophenyl)-4-N-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1ncnc(Nc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C11H14N6/c1-2-13-10-14-7-15-11(17-10)16-9-5-3-8(12)4-6-9/h3-7H,2,12H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | KLGDSHUEKCYMDA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|