C13H16N4 — CID 61240712
4-N-(6-propylpyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 61240712) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 4-N-(6-propylpyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(6-propylpyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61240712 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-N-(6-propylpyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | CCCc1cc(Nc2ccc(N)cc2)ncn1 |
| InChI | InChI=1S/C13H16N4/c1-2-3-12-8-13(16-9-15-12)17-11-6-4-10(14)5-7-11/h4-9H,2-3,14H2,1H3,(H,15,16,17) |
| InChIKey | PHYHADUIFCXNCZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|