C15H18N6O — CID 174500716
N-[6-(4-aminoanilino)pyrimidin-4-yl]-2-iminopentanamide (PubChem CID 174500716) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[6-(4-aminoanilino)pyrimidin-4-yl]-2-iminopentanamide.
| Compound Name | N-[6-(4-aminoanilino)pyrimidin-4-yl]-2-iminopentanamide |
|---|---|
| PubChem CID | 174500716 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[6-(4-aminoanilino)pyrimidin-4-yl]-2-iminopentanamide |
| SMILES | [H]/N=C(\CCC)C(=O)Nc1cc(Nc2ccc(N)cc2)ncn1 |
| InChI | InChI=1S/C15H18N6O/c1-2-3-12(17)15(22)21-14-8-13(18-9-19-14)20-11-6-4-10(16)5-7-11/h4-9,17H,2-3,16H2,1H3,(H2,18,19,20,21,22)/b17-12+ |
| InChIKey | DPOGMAOHMQMYQN-SFQUDFHCSA-N |
| XLogP | 2.56 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|