C24H25N7O2S — CID 174515002
2-imino-N-[6-[4-[(2-phenylacetyl)carbamothioylamino]anilino]pyrimidin-4-yl]pentanamide (PubChem CID 174515002) has the molecular formula C24H25N7O2S and a molecular weight of 475.58 g/mol. Its IUPAC name is 2-imino-N-[6-[4-[(2-phenylacetyl)carbamothioylamino]anilino]pyrimidin-4-yl]pentanamide.
| Compound Name | 2-imino-N-[6-[4-[(2-phenylacetyl)carbamothioylamino]anilino]pyrimidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 174515002 |
| Molecular Formula | C24H25N7O2S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-imino-N-[6-[4-[(2-phenylacetyl)carbamothioylamino]anilino]pyrimidin-4-yl]pentanamide |
| SMILES | [H]/N=C(\CCC)C(=O)Nc1cc(Nc2ccc(NC(=S)NC(=O)Cc3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C24H25N7O2S/c1-2-6-19(25)23(33)30-21-14-20(26-15-27-21)28-17-9-11-18(12-10-17)29-24(34)31-22(32)13-16-7-4-3-5-8-16/h3-5,7-12,14-15,25H,2,6,13H2,1H3,(H2,29,31,32,34)(H2,26,27,28,30,33)/b25-19+ |
| InChIKey | DIABQUDFBOSYFW-NCELDCMTSA-N |
| XLogP | 4.03 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|