C18H18ClN7O — CID 165164596
1-[6-(4-aminoanilino)pyrimidin-4-yl]-3-(5-amino-2-chlorophenyl)-1-methylurea (PubChem CID 165164596) has the molecular formula C18H18ClN7O and a molecular weight of 383.84 g/mol. Its IUPAC name is 1-[6-(4-aminoanilino)pyrimidin-4-yl]-3-(5-amino-2-chlorophenyl)-1-methylurea.
| Compound Name | 1-[6-(4-aminoanilino)pyrimidin-4-yl]-3-(5-amino-2-chlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 165164596 |
| Molecular Formula | C18H18ClN7O |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-[6-(4-aminoanilino)pyrimidin-4-yl]-3-(5-amino-2-chlorophenyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1cc(N)ccc1Cl)c1cc(Nc2ccc(N)cc2)ncn1 |
| InChI | InChI=1S/C18H18ClN7O/c1-26(18(27)25-15-8-12(21)4-7-14(15)19)17-9-16(22-10-23-17)24-13-5-2-11(20)3-6-13/h2-10H,20-21H2,1H3,(H,25,27)(H,22,23,24) |
| InChIKey | AEJFWKHRPIDALT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|