C24H28N6O — CID 11154269
4-amino-N-[4-[[6-[cyclohexyl(methyl)amino]pyrimidin-4-yl]amino]phenyl]benzamide (PubChem CID 11154269) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-amino-N-[4-[[6-[cyclohexyl(methyl)amino]pyrimidin-4-yl]amino]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[[6-[cyclohexyl(methyl)amino]pyrimidin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 11154269 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-amino-N-[4-[[6-[cyclohexyl(methyl)amino]pyrimidin-4-yl]amino]phenyl]benzamide |
| SMILES | CN(c1cc(Nc2ccc(NC(=O)c3ccc(N)cc3)cc2)ncn1)C1CCCCC1 |
| InChI | InChI=1S/C24H28N6O/c1-30(21-5-3-2-4-6-21)23-15-22(26-16-27-23)28-19-11-13-20(14-12-19)29-24(31)17-7-9-18(25)10-8-17/h7-16,21H,2-6,25H2,1H3,(H,29,31)(H,26,27,28) |
| InChIKey | VOWJTRKFODJEAS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|