C21H27N5O2 — CID 56970219
4-[cyclopentyl(methyl)amino]-6-[4-(dimethylcarbamoyl)anilino]pyridine-3-carboxamide (PubChem CID 56970219) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[cyclopentyl(methyl)amino]-6-[4-(dimethylcarbamoyl)anilino]pyridine-3-carboxamide.
| Compound Name | 4-[cyclopentyl(methyl)amino]-6-[4-(dimethylcarbamoyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56970219 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-[cyclopentyl(methyl)amino]-6-[4-(dimethylcarbamoyl)anilino]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(Nc2cc(N(C)C3CCCC3)c(C(N)=O)cn2)cc1 |
| InChI | InChI=1S/C21H27N5O2/c1-25(2)21(28)14-8-10-15(11-9-14)24-19-12-18(17(13-23-19)20(22)27)26(3)16-6-4-5-7-16/h8-13,16H,4-7H2,1-3H3,(H2,22,27)(H,23,24) |
| InChIKey | LJBBUCJBOPRGBT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |