C19H24N4O3S — CID 59446976
6-[cyclohexyl(methyl)amino]-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide (PubChem CID 59446976) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 6-[cyclohexyl(methyl)amino]-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[cyclohexyl(methyl)amino]-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 59446976 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 6-[cyclohexyl(methyl)amino]-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide |
| SMILES | CN(c1cc(C(=O)Nc2ccc(S(C)(=O)=O)cc2)ncn1)C1CCCCC1 |
| InChI | InChI=1S/C19H24N4O3S/c1-23(15-6-4-3-5-7-15)18-12-17(20-13-21-18)19(24)22-14-8-10-16(11-9-14)27(2,25)26/h8-13,15H,3-7H2,1-2H3,(H,22,24) |
| InChIKey | LCBBKSUIEYLBFZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |