C19H25N5O2S — CID 59447103
6-(cyclohexylamino)-N-[4-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]pyrimidine-4-carboxamide (PubChem CID 59447103) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 6-(cyclohexylamino)-N-[4-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(cyclohexylamino)-N-[4-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 59447103 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6-(cyclohexylamino)-N-[4-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]pyrimidine-4-carboxamide |
| SMILES | C=S(C)(=O)Nc1ccc(NC(=O)c2cc(NC3CCCCC3)ncn2)cc1 |
| InChI | InChI=1S/C19H25N5O2S/c1-27(2,26)24-16-10-8-15(9-11-16)23-19(25)17-12-18(21-13-20-17)22-14-6-4-3-5-7-14/h8-14H,1,3-7H2,2H3,(H,23,25)(H,24,26)(H,20,21,22) |
| InChIKey | DFARZKLWQZLAFW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|