C13H13N3O4S — CID 121167413
6-methoxy-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide (PubChem CID 121167413) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 6-methoxy-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-methoxy-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121167413 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 6-methoxy-N-(4-methylsulfonylphenyl)pyrimidine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(C)(=O)=O)cc2)ncn1 |
| InChI | InChI=1S/C13H13N3O4S/c1-20-12-7-11(14-8-15-12)13(17)16-9-3-5-10(6-4-9)21(2,18)19/h3-8H,1-2H3,(H,16,17) |
| InChIKey | CEAYTWLVKIRITM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |