C16H21ClN4 — CID 112901298
4-N-(4-chlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112901298) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-chlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112901298 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-N-(4-chlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1nccc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H21ClN4/c1-3-11-21(12-4-2)16-18-10-9-15(20-16)19-14-7-5-13(17)6-8-14/h5-10H,3-4,11-12H2,1-2H3,(H,18,19,20) |
| InChIKey | YRZLWADVBOXMCH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |