C20H22N4O — CID 112899230
2-N,2-N-diethyl-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112899230) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899230 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1nccc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H22N4O/c1-3-24(4-2)20-21-15-14-19(23-20)22-16-10-12-18(13-11-16)25-17-8-6-5-7-9-17/h5-15H,3-4H2,1-2H3,(H,21,22,23) |
| InChIKey | VPQABVIAHDYYBD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |