C21H25N5O — CID 112960998
5-N-(4-phenoxyphenyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112960998) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-N-(4-phenoxyphenyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(4-phenoxyphenyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112960998 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-N-(4-phenoxyphenyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1nncc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C21H25N5O/c1-3-14-26(15-4-2)21-24-20(16-22-25-21)23-17-10-12-19(13-11-17)27-18-8-6-5-7-9-18/h5-13,16H,3-4,14-15H2,1-2H3,(H,23,24,25) |
| InChIKey | AIFKZGYFCIBSIU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |